![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| excel.jpg | 2023-12-13 14:05 | 4.5K | |
| sql hackr.jpg | 2023-12-13 14:05 | 5.0K | |
| intro python.jpg | 2023-12-13 14:05 | 5.2K | |
| data with python.jpg | 2023-12-13 14:05 | 5.9K | |
| excel matery.png | 2023-12-13 14:05 | 6.2K | |
| statistics with python.jpg | 2023-12-13 14:05 | 6.3K | |
| power bi.png | 2023-12-13 14:05 | 6.7K | |
| tableae cheat1.jpg | 2023-12-13 14:05 | 6.7K | |
| tableau.jpg | 2023-12-13 14:05 | 6.9K | |
| data visualazation.jpg | 2023-12-13 14:05 | 7.2K | |
| tableau quick.jpg | 2023-12-13 14:05 | 7.2K | |
| data and dashboard.jpg | 2023-12-13 14:05 | 7.6K | |
| sql 1.jpg | 2023-12-13 14:05 | 7.6K | |
| tableau cheat2.jpg | 2023-12-13 14:05 | 8.5K | |
| suprised advance.jpg | 2023-12-13 14:05 | 8.5K | |
| linear data structure.png | 2023-12-13 14:05 | 8.5K | |
| python library.png | 2023-12-13 14:05 | 8.9K | |
| sql web.jpg | 2023-12-13 14:05 | 9.0K | |
| ml superised.jpg | 2023-12-13 14:05 | 9.0K | |
| sql cheatsheet.png | 2023-12-13 14:05 | 9.5K | |
| reacursion with python.png | 2023-12-13 14:05 | 11K | |
| python hypothesis.png | 2023-12-13 14:05 | 11K | |
| hantonworks.png | 2023-12-13 14:05 | 12K | |
| chart.png | 2023-12-13 14:05 | 13K | |
| statistics for data analyss.png | 2023-12-13 14:05 | 13K | |
| complex data structure.png | 2023-12-13 14:05 | 14K | |
| dta science with pandas.png | 2023-12-13 14:05 | 17K | |
| hackr excel.png | 2023-12-13 14:05 | 18K | |
| sql server4.png | 2023-12-13 14:05 | 18K | |
| natural language.png | 2023-12-13 14:05 | 20K | |
| ml unsuperised.png | 2023-12-13 14:05 | 21K | |
